C18H21F3N2O5 — CID 10173007
2-[methyl-[4-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]butanoyl]amino]acetic acid (PubChem CID 10173007) has the molecular formula C18H21F3N2O5 and a molecular weight of 402.37 g/mol. Its IUPAC name is 2-[methyl-[4-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]butanoyl]amino]acetic acid.
| Compound Name | 2-[methyl-[4-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]butanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 10173007 |
| Molecular Formula | C18H21F3N2O5 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[methyl-[4-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]butanoyl]amino]acetic acid |
| SMILES | CCCc1c(OCCCC(=O)N(C)CC(=O)O)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C18H21F3N2O5/c1-3-5-11-13(27-9-4-6-14(24)23(2)10-15(25)26)8-7-12-16(11)28-22-17(12)18(19,20)21/h7-8H,3-6,9-10H2,1-2H3,(H,25,26) |
| InChIKey | RIIVUUBHHHARDS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|