C23H21F3N2O4 — CID 11775185
1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]indole-2-carboxylic acid (PubChem CID 11775185) has the molecular formula C23H21F3N2O4 and a molecular weight of 446.43 g/mol. Its IUPAC name is 1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]indole-2-carboxylic acid.
| Compound Name | 1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 11775185 |
| Molecular Formula | C23H21F3N2O4 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]indole-2-carboxylic acid |
| SMILES | CCCc1c(OCCCn2c(C(=O)O)cc3ccccc32)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C23H21F3N2O4/c1-2-6-15-19(10-9-16-20(15)32-27-21(16)23(24,25)26)31-12-5-11-28-17-8-4-3-7-14(17)13-18(28)22(29)30/h3-4,7-10,13H,2,5-6,11-12H2,1H3,(H,29,30) |
| InChIKey | UAGZCBWSSVCGLO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|