C7H4O3 — CID 138455198
furo[2,3-c]pyran-5-one (PubChem CID 138455198) has the molecular formula C7H4O3 and a molecular weight of 136.11 g/mol. Its IUPAC name is furo[2,3-c]pyran-5-one.
| Compound Name | furo[2,3-c]pyran-5-one |
|---|---|
| PubChem CID | 138455198 |
| Molecular Formula | C7H4O3 |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.02 |
| IUPAC Name | furo[2,3-c]pyran-5-one |
| SMILES | O=c1cc2ccoc2co1 |
| InChI | InChI=1S/C7H4O3/c8-7-3-5-1-2-9-6(5)4-10-7/h1-4H |
| InChIKey | BTWHWKIMXARRCB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |