About 1-benzofuran-5-carbonyl iodide
1-benzofuran-5-carbonyl iodide (PubChem CID 143843606) has the molecular formula C9H5IO2
and a molecular weight of 272.04 g/mol. Its IUPAC name is 1-benzofuran-5-carbonyl iodide.
Molecular Properties
| Compound Name | 1-benzofuran-5-carbonyl iodide |
| PubChem CID | 143843606 |
| Molecular Formula | C9H5IO2 |
| Molecular Weight | 272.04 g/mol |
| Exact Mass | 271.93 |
| IUPAC Name | 1-benzofuran-5-carbonyl iodide |
| SMILES | O=C(I)c1ccc2occc2c1 |
| InChI | InChI=1S/C9H5IO2/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H |
| InChIKey | BYEGPBFISQEKEM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.04 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran-5-carbonyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-5-carbonyl iodide?
The IUPAC name of 1-benzofuran-5-carbonyl iodide (CID 143843606) is 1-benzofuran-5-carbonyl iodide.
What is the SMILES notation for 1-benzofuran-5-carbonyl iodide?
The canonical SMILES for 1-benzofuran-5-carbonyl iodide is O=C(I)c1ccc2occc2c1.
What is the InChIKey of 1-benzofuran-5-carbonyl iodide?
The InChIKey is BYEGPBFISQEKEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5IO2/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H.
What are the key properties of 1-benzofuran-5-carbonyl iodide?
1-benzofuran-5-carbonyl iodide has a molecular weight of 272.04 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-5-carbonyl iodide is sourced from PubChem (CID 143843606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).