C24H14O11 — CID 123662042
(6,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl) 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 123662042) has the molecular formula C24H14O11 and a molecular weight of 478.37 g/mol. Its IUPAC name is (6,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl) 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | (6,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl) 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 123662042 |
| Molecular Formula | C24H14O11 |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | (6,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl) 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)Oc2c(O)cc3c(=O)oc4c(O)c(O)cc5c(=O)oc2c3c45)ccc1O |
| InChI | InChI=1S/C24H14O11/c1-32-15-6-9(2-4-12(15)25)3-5-16(28)33-20-14(27)8-11-18-17-10(24(31)35-22(18)20)7-13(26)19(29)21(17)34-23(11)30/h2-8,25-27,29H,1H3 |
| InChIKey | LFZOJWXXSTWLLD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 176.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|