C19H14O6 — CID 102460368
(2-oxochromen-3-yl) (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 102460368) has the molecular formula C19H14O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is (2-oxochromen-3-yl) (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | (2-oxochromen-3-yl) (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 102460368 |
| Molecular Formula | C19H14O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (2-oxochromen-3-yl) (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2cc3ccccc3oc2=O)ccc1O |
| InChI | InChI=1S/C19H14O6/c1-23-16-10-12(6-8-14(16)20)7-9-18(21)24-17-11-13-4-2-3-5-15(13)25-19(17)22/h2-11,20H,1H3/b9-7+ |
| InChIKey | YNQRWYRDRXSZKK-VQHVLOKHSA-N |
| XLogP | 3.13 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|