C18H10O10 — CID 15006880
(14-acetyloxy-6,13-dihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl) acetate (PubChem CID 15006880) has the molecular formula C18H10O10 and a molecular weight of 386.27 g/mol. Its IUPAC name is (14-acetyloxy-6,13-dihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl) acetate.
| Compound Name | (14-acetyloxy-6,13-dihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl) acetate |
|---|---|
| PubChem CID | 15006880 |
| Molecular Formula | C18H10O10 |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | (14-acetyloxy-6,13-dihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-7-yl) acetate |
| SMILES | CC(=O)Oc1c(O)cc2c(=O)oc3c(OC(C)=O)c(O)cc4c(=O)oc1c2c34 |
| InChI | InChI=1S/C18H10O10/c1-5(19)25-13-9(21)3-7-11-12-8(17(23)27-15(11)13)4-10(22)14(26-6(2)20)16(12)28-18(7)24/h3-4,21-22H,1-2H3 |
| InChIKey | ONFFBSKUEYAWDN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 153.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|