C17H14O2 — CID 162808864
(3S)-3-(2-phenylethenyl)-3,4-dihydroisochromen-1-one (PubChem CID 162808864) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (3S)-3-(2-phenylethenyl)-3,4-dihydroisochromen-1-one.
| Compound Name | (3S)-3-(2-phenylethenyl)-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 162808864 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (3S)-3-(2-phenylethenyl)-3,4-dihydroisochromen-1-one |
| SMILES | O=C1O[C@H](C=Cc2ccccc2)Cc2ccccc21 |
| InChI | InChI=1S/C17H14O2/c18-17-16-9-5-4-8-14(16)12-15(19-17)11-10-13-6-2-1-3-7-13/h1-11,15H,12H2/t15-/m1/s1 |
| InChIKey | HSAHMKMXDFLDBH-OAHLLOKOSA-N |
| XLogP | 3.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |