C17H13NO4 — CID 7055609
(3R)-3-[(E)-2-(4-nitrophenyl)ethenyl]-3,4-dihydroisochromen-1-one (PubChem CID 7055609) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is (3R)-3-[(E)-2-(4-nitrophenyl)ethenyl]-3,4-dihydroisochromen-1-one.
| Compound Name | (3R)-3-[(E)-2-(4-nitrophenyl)ethenyl]-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 7055609 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (3R)-3-[(E)-2-(4-nitrophenyl)ethenyl]-3,4-dihydroisochromen-1-one |
| SMILES | O=C1O[C@@H](/C=C/c2ccc([N+](=O)[O-])cc2)Cc2ccccc21 |
| InChI | InChI=1S/C17H13NO4/c19-17-16-4-2-1-3-13(16)11-15(22-17)10-7-12-5-8-14(9-6-12)18(20)21/h1-10,15H,11H2/b10-7+/t15-/m0/s1 |
| InChIKey | TVJIWJQSYXWXMR-VSGCLNPGSA-N |
| XLogP | 3.39 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|