C20H14O3 — CID 101138704
2-[(E)-2-phenylethenyl]-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione (PubChem CID 101138704) has the molecular formula C20H14O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-[(E)-2-phenylethenyl]-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione.
| Compound Name | 2-[(E)-2-phenylethenyl]-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 101138704 |
| Molecular Formula | C20H14O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-[(E)-2-phenylethenyl]-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione |
| SMILES | O=C1C2=C(OC(/C=C/c3ccccc3)C2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H14O3/c21-18-15-8-4-5-9-16(15)19(22)20-17(18)12-14(23-20)11-10-13-6-2-1-3-7-13/h1-11,14H,12H2/b11-10+ |
| InChIKey | AATNKPJLWVMMGQ-ZHACJKMWSA-N |
| XLogP | 3.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|