C11H11N3O3 — CID 67151593
4-[2-(4-nitrophenyl)ethenyl]-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 67151593) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 4-[2-(4-nitrophenyl)ethenyl]-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | 4-[2-(4-nitrophenyl)ethenyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 67151593 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 4-[2-(4-nitrophenyl)ethenyl]-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | NC1=NC(C=Cc2ccc([N+](=O)[O-])cc2)CO1 |
| InChI | InChI=1S/C11H11N3O3/c12-11-13-9(7-17-11)4-1-8-2-5-10(6-3-8)14(15)16/h1-6,9H,7H2,(H2,12,13) |
| InChIKey | SDHITWLVARINKA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|