C14H13NO2 — CID 100932380
1-[(E)-2-(2-methylcyclopenta-2,4-dien-1-yl)ethenyl]-4-nitrobenzene (PubChem CID 100932380) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-[(E)-2-(2-methylcyclopenta-2,4-dien-1-yl)ethenyl]-4-nitrobenzene.
| Compound Name | 1-[(E)-2-(2-methylcyclopenta-2,4-dien-1-yl)ethenyl]-4-nitrobenzene |
|---|---|
| PubChem CID | 100932380 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 1-[(E)-2-(2-methylcyclopenta-2,4-dien-1-yl)ethenyl]-4-nitrobenzene |
| SMILES | CC1=CC=CC1/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H13NO2/c1-11-3-2-4-13(11)8-5-12-6-9-14(10-7-12)15(16)17/h2-10,13H,1H3/b8-5+ |
| InChIKey | XNZILKINQRLJHV-VMPITWQZSA-N |
| XLogP | 3.74 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|