C13H11NO3 — CID 100932382
2-[(E)-2-(4-nitrophenyl)ethenyl]cyclopenta-2,4-dien-1-ol (PubChem CID 100932382) has the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-[(E)-2-(4-nitrophenyl)ethenyl]cyclopenta-2,4-dien-1-ol.
| Compound Name | 2-[(E)-2-(4-nitrophenyl)ethenyl]cyclopenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 100932382 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-[(E)-2-(4-nitrophenyl)ethenyl]cyclopenta-2,4-dien-1-ol |
| SMILES | O=[N+]([O-])c1ccc(/C=C/C2=CC=CC2O)cc1 |
| InChI | InChI=1S/C13H11NO3/c15-13-3-1-2-11(13)7-4-10-5-8-12(9-6-10)14(16)17/h1-9,13,15H/b7-4+ |
| InChIKey | OEPBRMJWRMQGNM-QPJJXVBHSA-N |
| XLogP | 2.47 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|