C11H10O2 — CID 122202366
(3R)-3-ethenyl-3,4-dihydroisochromen-1-one (PubChem CID 122202366) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is (3R)-3-ethenyl-3,4-dihydroisochromen-1-one.
| Compound Name | (3R)-3-ethenyl-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 122202366 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (3R)-3-ethenyl-3,4-dihydroisochromen-1-one |
| SMILES | C=C[C@H]1Cc2ccccc2C(=O)O1 |
| InChI | InChI=1S/C11H10O2/c1-2-9-7-8-5-3-4-6-10(8)11(12)13-9/h2-6,9H,1,7H2/t9-/m0/s1 |
| InChIKey | SXILXKBOHZXSLQ-VIFPVBQESA-N |
| XLogP | 1.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|