C15H12NO4- — CID 163142698
3-[4-[hydroxy(oxido)amino]phenyl]-3,4-dihydroisochromen-1-one (PubChem CID 163142698) has the molecular formula C15H12NO4- and a molecular weight of 270.26 g/mol. Its IUPAC name is 3-[4-[hydroxy(oxido)amino]phenyl]-3,4-dihydroisochromen-1-one.
| Compound Name | 3-[4-[hydroxy(oxido)amino]phenyl]-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 163142698 |
| Molecular Formula | C15H12NO4- |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 3-[4-[hydroxy(oxido)amino]phenyl]-3,4-dihydroisochromen-1-one |
| SMILES | O=C1OC(c2ccc(N([O-])O)cc2)Cc2ccccc21 |
| InChI | InChI=1S/C15H12NO4/c17-15-13-4-2-1-3-11(13)9-14(20-15)10-5-7-12(8-6-10)16(18)19/h1-8,14,18H,9H2/q-1 |
| InChIKey | RTBHOJYCDMRNST-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|