C15H14O10P2+2 — CID 175725603
bis(dihydroxy(oxo)phosphanium);7,8-dihydroxy-2-phenylchromen-4-one (PubChem CID 175725603) has the molecular formula C15H14O10P2+2 and a molecular weight of 416.22 g/mol. Its IUPAC name is bis(dihydroxy(oxo)phosphanium);7,8-dihydroxy-2-phenylchromen-4-one.
| Compound Name | bis(dihydroxy(oxo)phosphanium);7,8-dihydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 175725603 |
| Molecular Formula | C15H14O10P2+2 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | bis(dihydroxy(oxo)phosphanium);7,8-dihydroxy-2-phenylchromen-4-one |
| SMILES | O=[P+](O)O.O=[P+](O)O.O=c1cc(-c2ccccc2)oc2c(O)c(O)ccc12 |
| InChI | InChI=1S/C15H10O4.2HO3P/c16-11-7-6-10-12(17)8-13(19-15(10)14(11)18)9-4-2-1-3-5-9;2*1-4(2)3/h1-8,16,18H;2*(H-,1,2,3)/p+2 |
| InChIKey | MOMYNVWPJQHCCG-UHFFFAOYSA-P |
| XLogP | 2.13 |
| TPSA | 185.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|