C17H13NO5 — CID 146347086
(7-hydroxy-4-oxo-2-phenylchromen-8-yl) N-methylcarbamate (PubChem CID 146347086) has the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. Its IUPAC name is (7-hydroxy-4-oxo-2-phenylchromen-8-yl) N-methylcarbamate.
| Compound Name | (7-hydroxy-4-oxo-2-phenylchromen-8-yl) N-methylcarbamate |
|---|---|
| PubChem CID | 146347086 |
| Molecular Formula | C17H13NO5 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (7-hydroxy-4-oxo-2-phenylchromen-8-yl) N-methylcarbamate |
| SMILES | CNC(=O)Oc1c(O)ccc2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C17H13NO5/c1-18-17(21)23-16-12(19)8-7-11-13(20)9-14(22-15(11)16)10-5-3-2-4-6-10/h2-9,19H,1H3,(H,18,21) |
| InChIKey | FDCPGEIMPHKXFK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |