C17H14FNO4 — CID 54760248
2-[4-(dimethylamino)-3-fluorophenyl]-7,8-dihydroxychromen-4-one (PubChem CID 54760248) has the molecular formula C17H14FNO4 and a molecular weight of 315.30 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-3-fluorophenyl]-7,8-dihydroxychromen-4-one.
| Compound Name | 2-[4-(dimethylamino)-3-fluorophenyl]-7,8-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 54760248 |
| Molecular Formula | C17H14FNO4 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[4-(dimethylamino)-3-fluorophenyl]-7,8-dihydroxychromen-4-one |
| SMILES | CN(C)c1ccc(-c2cc(=O)c3ccc(O)c(O)c3o2)cc1F |
| InChI | InChI=1S/C17H14FNO4/c1-19(2)12-5-3-9(7-11(12)18)15-8-14(21)10-4-6-13(20)16(22)17(10)23-15/h3-8,20,22H,1-2H3 |
| InChIKey | ZNJKERFMNMKDIL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|