C15H9N3O4 — CID 135506549
2-(2H-benzotriazol-5-yl)-7,8-dihydroxychromen-4-one (PubChem CID 135506549) has the molecular formula C15H9N3O4 and a molecular weight of 295.25 g/mol. Its IUPAC name is 2-(2H-benzotriazol-5-yl)-7,8-dihydroxychromen-4-one.
| Compound Name | 2-(2H-benzotriazol-5-yl)-7,8-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 135506549 |
| Molecular Formula | C15H9N3O4 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-(2H-benzotriazol-5-yl)-7,8-dihydroxychromen-4-one |
| SMILES | O=c1cc(-c2ccc3n[nH]nc3c2)oc2c(O)c(O)ccc12 |
| InChI | InChI=1S/C15H9N3O4/c19-11-4-2-8-12(20)6-13(22-15(8)14(11)21)7-1-3-9-10(5-7)17-18-16-9/h1-6,19,21H,(H,16,17,18) |
| InChIKey | KXCJCQXVMZXNFS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|