C14H18O2 — CID 11435916
(3S)-5-methyl-3-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalene-1,8-diol (PubChem CID 11435916) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (3S)-5-methyl-3-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalene-1,8-diol.
| Compound Name | (3S)-5-methyl-3-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalene-1,8-diol |
|---|---|
| PubChem CID | 11435916 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (3S)-5-methyl-3-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalene-1,8-diol |
| SMILES | C=C(C)[C@H]1Cc2c(C)ccc(O)c2C(O)C1 |
| InChI | InChI=1S/C14H18O2/c1-8(2)10-6-11-9(3)4-5-12(15)14(11)13(16)7-10/h4-5,10,13,15-16H,1,6-7H2,2-3H3/t10-,13?/m0/s1 |
| InChIKey | VZOKKCWBOMXRSY-NKUHCKNESA-N |
| XLogP | 2.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|