C13H19NO2 — CID 105477797
3-(tert-butylamino)-3,4-dihydro-2H-chromen-5-ol (PubChem CID 105477797) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-(tert-butylamino)-3,4-dihydro-2H-chromen-5-ol.
| Compound Name | 3-(tert-butylamino)-3,4-dihydro-2H-chromen-5-ol |
|---|---|
| PubChem CID | 105477797 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-(tert-butylamino)-3,4-dihydro-2H-chromen-5-ol |
| SMILES | CC(C)(C)NC1COc2cccc(O)c2C1 |
| InChI | InChI=1S/C13H19NO2/c1-13(2,3)14-9-7-10-11(15)5-4-6-12(10)16-8-9/h4-6,9,14-15H,7-8H2,1-3H3 |
| InChIKey | JADKGLZHWNHKMD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |