C11H15NO2 — CID 13446113
3-(methylamino)-2,3,4,5-tetrahydro-1-benzoxepin-5-ol (PubChem CID 13446113) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-(methylamino)-2,3,4,5-tetrahydro-1-benzoxepin-5-ol.
| Compound Name | 3-(methylamino)-2,3,4,5-tetrahydro-1-benzoxepin-5-ol |
|---|---|
| PubChem CID | 13446113 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3-(methylamino)-2,3,4,5-tetrahydro-1-benzoxepin-5-ol |
| SMILES | CNC1COc2ccccc2C(O)C1 |
| InChI | InChI=1S/C11H15NO2/c1-12-8-6-10(13)9-4-2-3-5-11(9)14-7-8/h2-5,8,10,12-13H,6-7H2,1H3 |
| InChIKey | JWUPWOYNGNTOKD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |