4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid

C11H13NO3 — CID 84620861

IUPAC4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid
SMILESCc1cccc2c1N(C)CC(C(=O)O)O2
InChIInChI=1S/C11H13NO3/c1-7-4-3-5-8-10(7)12(2)6-9(15-8)11(13)14/h3-5,9H,6H2,1-2H3,(H,13,14)
InChIKeyWTONPMPDUSAZCZ-UHFFFAOYSA-N
MW207.23 g/mol
LogP1.28
Rot. Bonds1

About 4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid

4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 84620861) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.

Molecular Properties

Compound Name4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid
PubChem CID84620861
Molecular FormulaC11H13NO3
Molecular Weight207.23 g/mol
Exact Mass207.09
IUPAC Name4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid
SMILESCc1cccc2c1N(C)CC(C(=O)O)O2
InChIInChI=1S/C11H13NO3/c1-7-4-3-5-8-10(7)12(2)6-9(15-8)11(13)14/h3-5,9H,6H2,1-2H3,(H,13,14)
InChIKeyWTONPMPDUSAZCZ-UHFFFAOYSA-N
XLogP1.28
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.23
LogP ≤ 51.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid?
The IUPAC name of 4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (CID 84620861) is 4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
What is the SMILES notation for 4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid?
The canonical SMILES for 4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid is Cc1cccc2c1N(C)CC(C(=O)O)O2.
What is the InChIKey of 4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid?
The InChIKey is WTONPMPDUSAZCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-7-4-3-5-8-10(7)12(2)6-9(15-8)11(13)14/h3-5,9H,6H2,1-2H3,(H,13,14).
What are the key properties of 4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid?
4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid has a molecular weight of 207.23 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid is sourced from PubChem (CID 84620861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).