C10H12N2O3 — CID 84621046
6-amino-4-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 84621046) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 6-amino-4-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
| Compound Name | 6-amino-4-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
|---|---|
| PubChem CID | 84621046 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 6-amino-4-methyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| SMILES | CN1CC(C(=O)O)Oc2ccc(N)cc21 |
| InChI | InChI=1S/C10H12N2O3/c1-12-5-9(10(13)14)15-8-3-2-6(11)4-7(8)12/h2-4,9H,5,11H2,1H3,(H,13,14) |
| InChIKey | VNGVEKJSLLTOJX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|