2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid

C11H14N2O3 — CID 82025188

IUPAC2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid
SMILESCC1CN(CC(=O)O)c2cc(N)ccc2O1
InChIInChI=1S/C11H14N2O3/c1-7-5-13(6-11(14)15)9-4-8(12)2-3-10(9)16-7/h2-4,7H,5-6,12H2,1H3,(H,14,15)
InChIKeyJWVRFQJKAGFXOG-UHFFFAOYSA-N
MW222.24 g/mol
LogP0.94
Rot. Bonds2

About 2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid

2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid (PubChem CID 82025188) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid.

Molecular Properties

Compound Name2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid
PubChem CID82025188
Molecular FormulaC11H14N2O3
Molecular Weight222.24 g/mol
Exact Mass222.10
IUPAC Name2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid
SMILESCC1CN(CC(=O)O)c2cc(N)ccc2O1
InChIInChI=1S/C11H14N2O3/c1-7-5-13(6-11(14)15)9-4-8(12)2-3-10(9)16-7/h2-4,7H,5-6,12H2,1H3,(H,14,15)
InChIKeyJWVRFQJKAGFXOG-UHFFFAOYSA-N
XLogP0.94
TPSA75.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.24
LogP ≤ 50.94
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid?
The IUPAC name of 2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid (CID 82025188) is 2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid.
What is the SMILES notation for 2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid?
The canonical SMILES for 2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid is CC1CN(CC(=O)O)c2cc(N)ccc2O1.
What is the InChIKey of 2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid?
The InChIKey is JWVRFQJKAGFXOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3/c1-7-5-13(6-11(14)15)9-4-8(12)2-3-10(9)16-7/h2-4,7H,5-6,12H2,1H3,(H,14,15).
What are the key properties of 2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid?
2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid has a molecular weight of 222.24 g/mol, XLogP of 0.94, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)acetic acid is sourced from PubChem (CID 82025188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).