C16H17ClN2O — CID 82025211
4-[(4-chlorophenyl)methyl]-2-methyl-2,3-dihydro-1,4-benzoxazin-6-amine (PubChem CID 82025211) has the molecular formula C16H17ClN2O and a molecular weight of 288.78 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-2-methyl-2,3-dihydro-1,4-benzoxazin-6-amine.
| Compound Name | 4-[(4-chlorophenyl)methyl]-2-methyl-2,3-dihydro-1,4-benzoxazin-6-amine |
|---|---|
| PubChem CID | 82025211 |
| Molecular Formula | C16H17ClN2O |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-2-methyl-2,3-dihydro-1,4-benzoxazin-6-amine |
| SMILES | CC1CN(Cc2ccc(Cl)cc2)c2cc(N)ccc2O1 |
| InChI | InChI=1S/C16H17ClN2O/c1-11-9-19(10-12-2-4-13(17)5-3-12)15-8-14(18)6-7-16(15)20-11/h2-8,11H,9-10,18H2,1H3 |
| InChIKey | QJXYQDGFNBRNNE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|