C17H25N3O2 — CID 82025111
2-(7-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-1-(4-methylpiperidin-1-yl)ethanone (PubChem CID 82025111) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-(7-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-1-(4-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-(7-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-1-(4-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 82025111 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2-(7-amino-2-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-1-(4-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCN(C(=O)CN2CC(C)Oc3cc(N)ccc32)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-12-5-7-19(8-6-12)17(21)11-20-10-13(2)22-16-9-14(18)3-4-15(16)20/h3-4,9,12-13H,5-8,10-11,18H2,1-2H3 |
| InChIKey | DCCGTMCOXMHMAW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|