C9H6Cl2O3 — CID 165466053
4,5-dichloro-2,3-dihydro-1-benzofuran-2-carboxylic acid (PubChem CID 165466053) has the molecular formula C9H6Cl2O3 and a molecular weight of 233.05 g/mol. Its IUPAC name is 4,5-dichloro-2,3-dihydro-1-benzofuran-2-carboxylic acid.
| Compound Name | 4,5-dichloro-2,3-dihydro-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 165466053 |
| Molecular Formula | C9H6Cl2O3 |
| Molecular Weight | 233.05 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 4,5-dichloro-2,3-dihydro-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(O)C1Cc2c(ccc(Cl)c2Cl)O1 |
| InChI | InChI=1S/C9H6Cl2O3/c10-5-1-2-6-4(8(5)11)3-7(14-6)9(12)13/h1-2,7H,3H2,(H,12,13) |
| InChIKey | FXLKFHGXARSLIW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.05 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |