C11H15NO2 — CID 117200214
3-[2-(methylamino)ethyl]-2,3-dihydro-1-benzofuran-4-ol (PubChem CID 117200214) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-[2-(methylamino)ethyl]-2,3-dihydro-1-benzofuran-4-ol.
| Compound Name | 3-[2-(methylamino)ethyl]-2,3-dihydro-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 117200214 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3-[2-(methylamino)ethyl]-2,3-dihydro-1-benzofuran-4-ol |
| SMILES | CNCCC1COc2cccc(O)c21 |
| InChI | InChI=1S/C11H15NO2/c1-12-6-5-8-7-14-10-4-2-3-9(13)11(8)10/h2-4,8,12-13H,5-7H2,1H3 |
| InChIKey | VDWFDGLMPUHNBX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |