C14H18Cl2O3 — CID 139258977
(2S,3R,4S,5R,6S)-6-(2,6-dichlorophenyl)-2,3,5-trimethyloxane-2,4-diol (PubChem CID 139258977) has the molecular formula C14H18Cl2O3 and a molecular weight of 305.20 g/mol. Its IUPAC name is (2S,3R,4S,5R,6S)-6-(2,6-dichlorophenyl)-2,3,5-trimethyloxane-2,4-diol.
| Compound Name | (2S,3R,4S,5R,6S)-6-(2,6-dichlorophenyl)-2,3,5-trimethyloxane-2,4-diol |
|---|---|
| PubChem CID | 139258977 |
| Molecular Formula | C14H18Cl2O3 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (2S,3R,4S,5R,6S)-6-(2,6-dichlorophenyl)-2,3,5-trimethyloxane-2,4-diol |
| SMILES | C[C@@H]1[C@H](O)[C@@H](C)[C@@](C)(O)O[C@@H]1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H18Cl2O3/c1-7-12(17)8(2)14(3,18)19-13(7)11-9(15)5-4-6-10(11)16/h4-8,12-13,17-18H,1-3H3/t7-,8-,12+,13+,14+/m1/s1 |
| InChIKey | GUVQFLLBANFXJP-VJWDYSCTSA-N |
| XLogP | 3.41 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |