C17H12Cl2O4 — CID 13190793
(1S,9R,10R)-10-(2,6-dichlorophenyl)-1-methoxy-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one (PubChem CID 13190793) has the molecular formula C17H12Cl2O4 and a molecular weight of 351.19 g/mol. Its IUPAC name is (1S,9R,10R)-10-(2,6-dichlorophenyl)-1-methoxy-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one.
| Compound Name | (1S,9R,10R)-10-(2,6-dichlorophenyl)-1-methoxy-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 13190793 |
| Molecular Formula | C17H12Cl2O4 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | (1S,9R,10R)-10-(2,6-dichlorophenyl)-1-methoxy-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
| SMILES | CO[C@@]12O[C@H](c3c(Cl)cccc3Cl)[C@@H](O1)C(=O)c1ccccc12 |
| InChI | InChI=1S/C17H12Cl2O4/c1-21-17-10-6-3-2-5-9(10)14(20)16(23-17)15(22-17)13-11(18)7-4-8-12(13)19/h2-8,15-16H,1H3/t15-,16+,17+/m1/s1 |
| InChIKey | ZKBOUEPDCLDLNX-IKGGRYGDSA-N |
| XLogP | 4.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |