C25H20O3 — CID 11610338
(1R,9R,10S,12R)-1-methoxy-10,12-diphenyl-13-oxatetracyclo[7.3.1.02,7.010,12]trideca-2,4,6-trien-8-one (PubChem CID 11610338) has the molecular formula C25H20O3 and a molecular weight of 368.43 g/mol. Its IUPAC name is (1R,9R,10S,12R)-1-methoxy-10,12-diphenyl-13-oxatetracyclo[7.3.1.02,7.010,12]trideca-2,4,6-trien-8-one.
| Compound Name | (1R,9R,10S,12R)-1-methoxy-10,12-diphenyl-13-oxatetracyclo[7.3.1.02,7.010,12]trideca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 11610338 |
| Molecular Formula | C25H20O3 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (1R,9R,10S,12R)-1-methoxy-10,12-diphenyl-13-oxatetracyclo[7.3.1.02,7.010,12]trideca-2,4,6-trien-8-one |
| SMILES | CO[C@@]12O[C@@H](C(=O)c3ccccc31)[C@]1(c3ccccc3)C[C@]21c1ccccc1 |
| InChI | InChI=1S/C25H20O3/c1-27-25-20-15-9-8-14-19(20)21(26)22(28-25)23(17-10-4-2-5-11-17)16-24(23,25)18-12-6-3-7-13-18/h2-15,22H,16H2,1H3/t22-,23+,24+,25+/m0/s1 |
| InChIKey | YTRVTXOVARHITM-ZYQDXHPFSA-N |
| XLogP | 4.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |