C30H16Cl2O4 — CID 10052078
2-(2-chlorophenyl)-2-[2-(2-chlorophenyl)-1,3-dioxoinden-2-yl]indene-1,3-dione (PubChem CID 10052078) has the molecular formula C30H16Cl2O4 and a molecular weight of 511.36 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-[2-(2-chlorophenyl)-1,3-dioxoinden-2-yl]indene-1,3-dione.
| Compound Name | 2-(2-chlorophenyl)-2-[2-(2-chlorophenyl)-1,3-dioxoinden-2-yl]indene-1,3-dione |
|---|---|
| PubChem CID | 10052078 |
| Molecular Formula | C30H16Cl2O4 |
| Molecular Weight | 511.36 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | 2-(2-chlorophenyl)-2-[2-(2-chlorophenyl)-1,3-dioxoinden-2-yl]indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1(c1ccccc1Cl)C1(c2ccccc2Cl)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H16Cl2O4/c31-23-15-7-5-13-21(23)29(25(33)17-9-1-2-10-18(17)26(29)34)30(22-14-6-8-16-24(22)32)27(35)19-11-3-4-12-20(19)28(30)36/h1-16H |
| InChIKey | FRHIWFRKXLEHKT-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.36 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|