C9H8O5 — CID 141431232
2,2,3,3-tetrahydroxyinden-1-one (PubChem CID 141431232) has the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. Its IUPAC name is 2,2,3,3-tetrahydroxyinden-1-one.
| Compound Name | 2,2,3,3-tetrahydroxyinden-1-one |
|---|---|
| PubChem CID | 141431232 |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 2,2,3,3-tetrahydroxyinden-1-one |
| SMILES | O=C1c2ccccc2C(O)(O)C1(O)O |
| InChI | InChI=1S/C9H8O5/c10-7-5-3-1-2-4-6(5)8(11,12)9(7,13)14/h1-4,11-14H |
| InChIKey | VBKFDKLOKLHIRG-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|