C11H8O2 — CID 14813467
8-hydroxy-8-prop-1-ynylbicyclo[4.2.0]octa-1,3,5-trien-7-one (PubChem CID 14813467) has the molecular formula C11H8O2 and a molecular weight of 172.18 g/mol. Its IUPAC name is 8-hydroxy-8-prop-1-ynylbicyclo[4.2.0]octa-1,3,5-trien-7-one.
| Compound Name | 8-hydroxy-8-prop-1-ynylbicyclo[4.2.0]octa-1,3,5-trien-7-one |
|---|---|
| PubChem CID | 14813467 |
| Molecular Formula | C11H8O2 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 8-hydroxy-8-prop-1-ynylbicyclo[4.2.0]octa-1,3,5-trien-7-one |
| SMILES | CC#CC1(O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C11H8O2/c1-2-7-11(13)9-6-4-3-5-8(9)10(11)12/h3-6,13H,1H3 |
| InChIKey | XYKCOUNKVNHCGN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|