About 2-(2,6-dichlorophenyl)-3,3-dimethylazetidine
2-(2,6-dichlorophenyl)-3,3-dimethylazetidine (PubChem CID 130574989) has the molecular formula C11H13Cl2N
and a molecular weight of 230.14 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-3,3-dimethylazetidine.
Molecular Properties
| Compound Name | 2-(2,6-dichlorophenyl)-3,3-dimethylazetidine |
| PubChem CID | 130574989 |
| Molecular Formula | C11H13Cl2N |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-3,3-dimethylazetidine |
| SMILES | CC1(C)CNC1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H13Cl2N/c1-11(2)6-14-10(11)9-7(12)4-3-5-8(9)13/h3-5,10,14H,6H2,1-2H3 |
| InChIKey | ZJEFRIWOUQYRII-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,6-dichlorophenyl)-3,3-dimethylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dichlorophenyl)-3,3-dimethylazetidine?
The IUPAC name of 2-(2,6-dichlorophenyl)-3,3-dimethylazetidine (CID 130574989) is 2-(2,6-dichlorophenyl)-3,3-dimethylazetidine.
What is the SMILES notation for 2-(2,6-dichlorophenyl)-3,3-dimethylazetidine?
The canonical SMILES for 2-(2,6-dichlorophenyl)-3,3-dimethylazetidine is CC1(C)CNC1c1c(Cl)cccc1Cl.
What is the InChIKey of 2-(2,6-dichlorophenyl)-3,3-dimethylazetidine?
The InChIKey is ZJEFRIWOUQYRII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2N/c1-11(2)6-14-10(11)9-7(12)4-3-5-8(9)13/h3-5,10,14H,6H2,1-2H3.
What are the key properties of 2-(2,6-dichlorophenyl)-3,3-dimethylazetidine?
2-(2,6-dichlorophenyl)-3,3-dimethylazetidine has a molecular weight of 230.14 g/mol, XLogP of 3.66, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dichlorophenyl)-3,3-dimethylazetidine is sourced from PubChem (CID 130574989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).