C10H7Cl2NO2 — CID 163627145
3-(2,6-dichlorophenyl)pyrrolidine-2,5-dione (PubChem CID 163627145) has the molecular formula C10H7Cl2NO2 and a molecular weight of 244.08 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(2,6-dichlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 163627145 |
| Molecular Formula | C10H7Cl2NO2 |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 3-(2,6-dichlorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2c(Cl)cccc2Cl)C(=O)N1 |
| InChI | InChI=1S/C10H7Cl2NO2/c11-6-2-1-3-7(12)9(6)5-4-8(14)13-10(5)15/h1-3,5H,4H2,(H,13,14,15) |
| InChIKey | HSZNXKWYPMEQAG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|