C15H18Cl2O — CID 65174607
3-[(2,6-dichlorophenyl)methyl]-5,5-dimethylcyclohex-2-en-1-ol (PubChem CID 65174607) has the molecular formula C15H18Cl2O and a molecular weight of 285.21 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methyl]-5,5-dimethylcyclohex-2-en-1-ol.
| Compound Name | 3-[(2,6-dichlorophenyl)methyl]-5,5-dimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 65174607 |
| Molecular Formula | C15H18Cl2O |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methyl]-5,5-dimethylcyclohex-2-en-1-ol |
| SMILES | CC1(C)CC(Cc2c(Cl)cccc2Cl)=CC(O)C1 |
| InChI | InChI=1S/C15H18Cl2O/c1-15(2)8-10(6-11(18)9-15)7-12-13(16)4-3-5-14(12)17/h3-6,11,18H,7-9H2,1-2H3 |
| InChIKey | AGJPLHWURGYJKB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|