C15H17F3O2 — CID 65176983
5,5-dimethyl-3-[3-(trifluoromethoxy)phenyl]cyclohex-2-en-1-ol (PubChem CID 65176983) has the molecular formula C15H17F3O2 and a molecular weight of 286.29 g/mol. Its IUPAC name is 5,5-dimethyl-3-[3-(trifluoromethoxy)phenyl]cyclohex-2-en-1-ol.
| Compound Name | 5,5-dimethyl-3-[3-(trifluoromethoxy)phenyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 65176983 |
| Molecular Formula | C15H17F3O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 5,5-dimethyl-3-[3-(trifluoromethoxy)phenyl]cyclohex-2-en-1-ol |
| SMILES | CC1(C)CC(c2cccc(OC(F)(F)F)c2)=CC(O)C1 |
| InChI | InChI=1S/C15H17F3O2/c1-14(2)8-11(6-12(19)9-14)10-4-3-5-13(7-10)20-15(16,17)18/h3-7,12,19H,8-9H2,1-2H3 |
| InChIKey | JCFCYPJSUCVPNH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |