C15H19F3O2 — CID 81415026
2,2-diethyl-3-[3-(trifluoromethoxy)phenyl]cyclobutan-1-ol (PubChem CID 81415026) has the molecular formula C15H19F3O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2,2-diethyl-3-[3-(trifluoromethoxy)phenyl]cyclobutan-1-ol.
| Compound Name | 2,2-diethyl-3-[3-(trifluoromethoxy)phenyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 81415026 |
| Molecular Formula | C15H19F3O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2,2-diethyl-3-[3-(trifluoromethoxy)phenyl]cyclobutan-1-ol |
| SMILES | CCC1(CC)C(O)CC1c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3O2/c1-3-14(4-2)12(9-13(14)19)10-6-5-7-11(8-10)20-15(16,17)18/h5-8,12-13,19H,3-4,9H2,1-2H3 |
| InChIKey | IHBPXQDAGKQIAQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |