C17H22F3NO2 — CID 153367461
(1S,2S,4S)-2-pyrrolidin-1-yl-4-[3-(trifluoromethoxy)phenyl]cyclohexan-1-ol (PubChem CID 153367461) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is (1S,2S,4S)-2-pyrrolidin-1-yl-4-[3-(trifluoromethoxy)phenyl]cyclohexan-1-ol.
| Compound Name | (1S,2S,4S)-2-pyrrolidin-1-yl-4-[3-(trifluoromethoxy)phenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 153367461 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (1S,2S,4S)-2-pyrrolidin-1-yl-4-[3-(trifluoromethoxy)phenyl]cyclohexan-1-ol |
| SMILES | O[C@H]1CC[C@H](c2cccc(OC(F)(F)F)c2)C[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C17H22F3NO2/c18-17(19,20)23-14-5-3-4-12(10-14)13-6-7-16(22)15(11-13)21-8-1-2-9-21/h3-5,10,13,15-16,22H,1-2,6-9,11H2/t13-,15-,16-/m0/s1 |
| InChIKey | YIRJJJGKNDXFSG-BPUTZDHNSA-N |
| XLogP | 3.68 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |