C16H22F3NO — CID 43108619
3-(trifluoromethoxy)-N-(3,3,5-trimethylcyclohexyl)aniline (PubChem CID 43108619) has the molecular formula C16H22F3NO and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-(trifluoromethoxy)-N-(3,3,5-trimethylcyclohexyl)aniline.
| Compound Name | 3-(trifluoromethoxy)-N-(3,3,5-trimethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 43108619 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 3-(trifluoromethoxy)-N-(3,3,5-trimethylcyclohexyl)aniline |
| SMILES | CC1CC(Nc2cccc(OC(F)(F)F)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C16H22F3NO/c1-11-7-13(10-15(2,3)9-11)20-12-5-4-6-14(8-12)21-16(17,18)19/h4-6,8,11,13,20H,7,9-10H2,1-3H3 |
| InChIKey | YCFOKUVEWDPSIG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |