About 6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine
6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine (PubChem CID 82811681) has the molecular formula C15H21F3N2
and a molecular weight of 286.34 g/mol. Its IUPAC name is 6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine |
| PubChem CID | 82811681 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine |
| SMILES | CC1CC(Nc2ccc(C(F)(F)F)nc2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H21F3N2/c1-10-6-12(8-14(2,3)7-10)20-11-4-5-13(19-9-11)15(16,17)18/h4-5,9-10,12,20H,6-8H2,1-3H3 |
| InChIKey | KUGJKWQHVVVTGU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine?
The IUPAC name of 6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine (CID 82811681) is 6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine.
What is the SMILES notation for 6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine?
The canonical SMILES for 6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine is CC1CC(Nc2ccc(C(F)(F)F)nc2)CC(C)(C)C1.
What is the InChIKey of 6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine?
The InChIKey is KUGJKWQHVVVTGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F3N2/c1-10-6-12(8-14(2,3)7-10)20-11-4-5-13(19-9-11)15(16,17)18/h4-5,9-10,12,20H,6-8H2,1-3H3.
What are the key properties of 6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine?
6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine has a molecular weight of 286.34 g/mol, XLogP of 4.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-N-(3,3,5-trimethylcyclohexyl)pyridin-3-amine is sourced from PubChem (CID 82811681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).