C13H17F3N2O — CID 82811776
N-(2,2-dimethyloxan-4-yl)-6-(trifluoromethyl)pyridin-3-amine (PubChem CID 82811776) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-6-(trifluoromethyl)pyridin-3-amine.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-6-(trifluoromethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 82811776 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-6-(trifluoromethyl)pyridin-3-amine |
| SMILES | CC1(C)CC(Nc2ccc(C(F)(F)F)nc2)CCO1 |
| InChI | InChI=1S/C13H17F3N2O/c1-12(2)7-9(5-6-19-12)18-10-3-4-11(17-8-10)13(14,15)16/h3-4,8-9,18H,5-7H2,1-2H3 |
| InChIKey | ZJWUDXFFRNDCOT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |