C12H18N2O — CID 83028490
N-(2,2-dimethyloxan-4-yl)pyridin-4-amine (PubChem CID 83028490) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)pyridin-4-amine.
| Compound Name | N-(2,2-dimethyloxan-4-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 83028490 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)pyridin-4-amine |
| SMILES | CC1(C)CC(Nc2ccncc2)CCO1 |
| InChI | InChI=1S/C12H18N2O/c1-12(2)9-11(5-8-15-12)14-10-3-6-13-7-4-10/h3-4,6-7,11H,5,8-9H2,1-2H3,(H,13,14) |
| InChIKey | FLJSJTMZWVLOON-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |