C10H17N3O — CID 106578747
N-(2,2-dimethyloxan-4-yl)-1H-imidazol-2-amine (PubChem CID 106578747) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-1H-imidazol-2-amine.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 106578747 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-1H-imidazol-2-amine |
| SMILES | CC1(C)CC(Nc2ncc[nH]2)CCO1 |
| InChI | InChI=1S/C10H17N3O/c1-10(2)7-8(3-6-14-10)13-9-11-4-5-12-9/h4-5,8H,3,6-7H2,1-2H3,(H2,11,12,13) |
| InChIKey | ULXDKBMVOCSQPW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |