C13H21N3O — CID 83027015
2-N-(2,2-dimethyloxan-4-yl)-5-methylpyridine-2,3-diamine (PubChem CID 83027015) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-N-(2,2-dimethyloxan-4-yl)-5-methylpyridine-2,3-diamine.
| Compound Name | 2-N-(2,2-dimethyloxan-4-yl)-5-methylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 83027015 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-N-(2,2-dimethyloxan-4-yl)-5-methylpyridine-2,3-diamine |
| SMILES | Cc1cnc(NC2CCOC(C)(C)C2)c(N)c1 |
| InChI | InChI=1S/C13H21N3O/c1-9-6-11(14)12(15-8-9)16-10-4-5-17-13(2,3)7-10/h6,8,10H,4-5,7,14H2,1-3H3,(H,15,16) |
| InChIKey | WAKMXEWAKUGRPE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |