C11H13Cl2NO5S — CID 129068497
[5-(2,6-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]-methylsulfamic acid (PubChem CID 129068497) has the molecular formula C11H13Cl2NO5S and a molecular weight of 342.20 g/mol. Its IUPAC name is [5-(2,6-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]-methylsulfamic acid.
| Compound Name | [5-(2,6-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]-methylsulfamic acid |
|---|---|
| PubChem CID | 129068497 |
| Molecular Formula | C11H13Cl2NO5S |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | [5-(2,6-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]-methylsulfamic acid |
| SMILES | CC1OC(c2c(Cl)cccc2Cl)C(N(C)S(=O)(=O)O)O1 |
| InChI | InChI=1S/C11H13Cl2NO5S/c1-6-18-10(9-7(12)4-3-5-8(9)13)11(19-6)14(2)20(15,16)17/h3-6,10-11H,1-2H3,(H,15,16,17) |
| InChIKey | MMJXOLZOTPBBLE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|