C11H15ClN2O5S — CID 122638297
[5-(4-chloro-3-pyridinyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-methylsulfamic acid (PubChem CID 122638297) has the molecular formula C11H15ClN2O5S and a molecular weight of 322.77 g/mol. Its IUPAC name is [5-(4-chloro-3-pyridinyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-methylsulfamic acid.
| Compound Name | [5-(4-chloro-3-pyridinyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-methylsulfamic acid |
|---|---|
| PubChem CID | 122638297 |
| Molecular Formula | C11H15ClN2O5S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | [5-(4-chloro-3-pyridinyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-methylsulfamic acid |
| SMILES | CN(C1OC(C)(C)OC1c1cnccc1Cl)S(=O)(=O)O |
| InChI | InChI=1S/C11H15ClN2O5S/c1-11(2)18-9(7-6-13-5-4-8(7)12)10(19-11)14(3)20(15,16)17/h4-6,9-10H,1-3H3,(H,15,16,17) |
| InChIKey | QUTOVSLDOKDBGC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|