C12H15Cl2NO3S — CID 129085034
S-[[5-(2,6-dichlorophenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]thiohydroxylamine (PubChem CID 129085034) has the molecular formula C12H15Cl2NO3S and a molecular weight of 324.23 g/mol. Its IUPAC name is S-[[5-(2,6-dichlorophenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]thiohydroxylamine.
| Compound Name | S-[[5-(2,6-dichlorophenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]thiohydroxylamine |
|---|---|
| PubChem CID | 129085034 |
| Molecular Formula | C12H15Cl2NO3S |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | S-[[5-(2,6-dichlorophenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]thiohydroxylamine |
| SMILES | CC1(C)OC(COSN)C(c2c(Cl)cccc2Cl)O1 |
| InChI | InChI=1S/C12H15Cl2NO3S/c1-12(2)17-9(6-16-19-15)11(18-12)10-7(13)4-3-5-8(10)14/h3-5,9,11H,6,15H2,1-2H3 |
| InChIKey | LLEZPESODJILLS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|